C20H14F4N4O2 — CID 123861427
2-fluoro-3-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-2-pyridinyl]prop-2-enoic acid (PubChem CID 123861427) has the molecular formula C20H14F4N4O2 and a molecular weight of 418.35 g/mol. Its IUPAC name is 2-fluoro-3-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-2-pyridinyl]prop-2-enoic acid.
| Compound Name | 2-fluoro-3-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 123861427 |
| Molecular Formula | C20H14F4N4O2 |
| Molecular Weight | 418.35 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 2-fluoro-3-[5-[3-methyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-2-pyridinyl]prop-2-enoic acid |
| SMILES | Cc1cc(Nc2nccc(C(F)(F)F)n2)cc(-c2ccc(C=C(F)C(=O)O)nc2)c1 |
| InChI | InChI=1S/C20H14F4N4O2/c1-11-6-13(12-2-3-14(26-10-12)9-16(21)18(29)30)8-15(7-11)27-19-25-5-4-17(28-19)20(22,23)24/h2-10H,1H3,(H,29,30)(H,25,27,28) |
| InChIKey | UQGLBHVBAZKCTJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|