C10H11NO2 — CID 118209456
2-(4-cyclopropyl-2-pyridinyl)acetic acid (PubChem CID 118209456) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-(4-cyclopropyl-2-pyridinyl)acetic acid.
| Compound Name | 2-(4-cyclopropyl-2-pyridinyl)acetic acid |
|---|---|
| PubChem CID | 118209456 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 2-(4-cyclopropyl-2-pyridinyl)acetic acid |
| SMILES | O=C(O)Cc1cc(C2CC2)ccn1 |
| InChI | InChI=1S/C10H11NO2/c12-10(13)6-9-5-8(3-4-11-9)7-1-2-7/h3-5,7H,1-2,6H2,(H,12,13) |
| InChIKey | DMIJRXWZIREWQW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |