C14H14F3NO4 — CID 118627334
[2-[4-(oxan-4-yl)-2-pyridinyl]acetyl] 2,2,2-trifluoroacetate (PubChem CID 118627334) has the molecular formula C14H14F3NO4 and a molecular weight of 317.26 g/mol. Its IUPAC name is [2-[4-(oxan-4-yl)-2-pyridinyl]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[4-(oxan-4-yl)-2-pyridinyl]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118627334 |
| Molecular Formula | C14H14F3NO4 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | [2-[4-(oxan-4-yl)-2-pyridinyl]acetyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Cc1cc(C2CCOCC2)ccn1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO4/c15-14(16,17)13(20)22-12(19)8-11-7-10(1-4-18-11)9-2-5-21-6-3-9/h1,4,7,9H,2-3,5-6,8H2 |
| InChIKey | VFGPOPZSBOSTOF-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|