C8H16N2S — CID 118210096
2-thia-6,10-diazaspiro[4.6]undecane (PubChem CID 118210096) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is 2-thia-6,10-diazaspiro[4.6]undecane.
| Compound Name | 2-thia-6,10-diazaspiro[4.6]undecane |
|---|---|
| PubChem CID | 118210096 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 2-thia-6,10-diazaspiro[4.6]undecane |
| SMILES | C1CNCC2(CCSC2)NC1 |
| InChI | InChI=1S/C8H16N2S/c1-3-9-6-8(10-4-1)2-5-11-7-8/h9-10H,1-7H2 |
| InChIKey | CWBGUESINRQTSF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |