C26H26ClN5O2 — CID 11821012
N-[(E)-(3-chlorophenyl)methylideneamino]-N-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]pyridine-4-carboxamide (PubChem CID 11821012) has the molecular formula C26H26ClN5O2 and a molecular weight of 475.98 g/mol. Its IUPAC name is N-[(E)-(3-chlorophenyl)methylideneamino]-N-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]pyridine-4-carboxamide.
| Compound Name | N-[(E)-(3-chlorophenyl)methylideneamino]-N-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 11821012 |
| Molecular Formula | C26H26ClN5O2 |
| Molecular Weight | 475.98 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | N-[(E)-(3-chlorophenyl)methylideneamino]-N-[2-[4-(3-methylphenyl)piperazin-1-yl]-2-oxoethyl]pyridine-4-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)CN(/N=C/c3cccc(Cl)c3)C(=O)c3ccncc3)CC2)c1 |
| InChI | InChI=1S/C26H26ClN5O2/c1-20-4-2-7-24(16-20)30-12-14-31(15-13-30)25(33)19-32(26(34)22-8-10-28-11-9-22)29-18-21-5-3-6-23(27)17-21/h2-11,16-18H,12-15,19H2,1H3/b29-18+ |
| InChIKey | QJFLUFBRUPZGTM-RDRPBHBLSA-N |
| XLogP | 3.87 |
| TPSA | 69.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.98 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|