C17H23FLiN3 — CID 118211876
lithium 1-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]-3H-pyrrolo[2,3-b]pyridin-3-ide (PubChem CID 118211876) has the molecular formula C17H23FLiN3 and a molecular weight of 295.33 g/mol. Its IUPAC name is lithium 1-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]-3H-pyrrolo[2,3-b]pyridin-3-ide.
| Compound Name | lithium 1-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]-3H-pyrrolo[2,3-b]pyridin-3-ide |
|---|---|
| PubChem CID | 118211876 |
| Molecular Formula | C17H23FLiN3 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | lithium 1-[[1-(2-fluoro-2-methylpropyl)piperidin-4-yl]methyl]-3H-pyrrolo[2,3-b]pyridin-3-ide |
| SMILES | CC(C)(F)CN1CCC(Cn2c[c-]c3cccnc32)CC1.[Li+] |
| InChI | InChI=1S/C17H23FN3.Li/c1-17(2,18)13-20-9-5-14(6-10-20)12-21-11-7-15-4-3-8-19-16(15)21;/h3-4,8,11,14H,5-6,9-10,12-13H2,1-2H3;/q-1;+1 |
| InChIKey | PEEKUZBSCCMNBX-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|