C12H20O2S2 — CID 11821360
(3,3-dimethyl-6,10-dithiaspiro[4.5]decan-4-yl) acetate (PubChem CID 11821360) has the molecular formula C12H20O2S2 and a molecular weight of 260.42 g/mol. Its IUPAC name is (3,3-dimethyl-6,10-dithiaspiro[4.5]decan-4-yl) acetate.
| Compound Name | (3,3-dimethyl-6,10-dithiaspiro[4.5]decan-4-yl) acetate |
|---|---|
| PubChem CID | 11821360 |
| Molecular Formula | C12H20O2S2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | (3,3-dimethyl-6,10-dithiaspiro[4.5]decan-4-yl) acetate |
| SMILES | CC(=O)OC1C(C)(C)CCC12SCCCS2 |
| InChI | InChI=1S/C12H20O2S2/c1-9(13)14-10-11(2,3)5-6-12(10)15-7-4-8-16-12/h10H,4-8H2,1-3H3 |
| InChIKey | BBBYEPHIHPLEEW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |