C17H30O3S2 — CID 91729968
ethyl 6-[[(3R,4S)-3-methyl-6,10-dithiaspiro[4.5]decan-4-yl]oxy]hexanoate (PubChem CID 91729968) has the molecular formula C17H30O3S2 and a molecular weight of 346.56 g/mol. Its IUPAC name is ethyl 6-[[(3R,4S)-3-methyl-6,10-dithiaspiro[4.5]decan-4-yl]oxy]hexanoate.
| Compound Name | ethyl 6-[[(3R,4S)-3-methyl-6,10-dithiaspiro[4.5]decan-4-yl]oxy]hexanoate |
|---|---|
| PubChem CID | 91729968 |
| Molecular Formula | C17H30O3S2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | ethyl 6-[[(3R,4S)-3-methyl-6,10-dithiaspiro[4.5]decan-4-yl]oxy]hexanoate |
| SMILES | CCOC(=O)CCCCCO[C@H]1[C@H](C)CCC12SCCCS2 |
| InChI | InChI=1S/C17H30O3S2/c1-3-19-15(18)8-5-4-6-11-20-16-14(2)9-10-17(16)21-12-7-13-22-17/h14,16H,3-13H2,1-2H3/t14-,16+/m1/s1 |
| InChIKey | YPQNWUPOGOIOFX-ZBFHGGJFSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|