C10H16O2S2 — CID 14070588
4-(1,3-dithiolan-2-yl)-5,6-dimethyloxan-2-one (PubChem CID 14070588) has the molecular formula C10H16O2S2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-(1,3-dithiolan-2-yl)-5,6-dimethyloxan-2-one.
| Compound Name | 4-(1,3-dithiolan-2-yl)-5,6-dimethyloxan-2-one |
|---|---|
| PubChem CID | 14070588 |
| Molecular Formula | C10H16O2S2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 4-(1,3-dithiolan-2-yl)-5,6-dimethyloxan-2-one |
| SMILES | CC1OC(=O)CC(C2SCCS2)C1C |
| InChI | InChI=1S/C10H16O2S2/c1-6-7(2)12-9(11)5-8(6)10-13-3-4-14-10/h6-8,10H,3-5H2,1-2H3 |
| InChIKey | PTDCOTJDZOSQCG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |