C10H20O2S2 — CID 143150505
5,6-dimethyl-4-(sulfanylmethylsulfanyl)oxan-2-one;ethane (PubChem CID 143150505) has the molecular formula C10H20O2S2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 5,6-dimethyl-4-(sulfanylmethylsulfanyl)oxan-2-one;ethane.
| Compound Name | 5,6-dimethyl-4-(sulfanylmethylsulfanyl)oxan-2-one;ethane |
|---|---|
| PubChem CID | 143150505 |
| Molecular Formula | C10H20O2S2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 5,6-dimethyl-4-(sulfanylmethylsulfanyl)oxan-2-one;ethane |
| SMILES | CC.CC1OC(=O)CC(SCS)C1C |
| InChI | InChI=1S/C8H14O2S2.C2H6/c1-5-6(2)10-8(9)3-7(5)12-4-11;1-2/h5-7,11H,3-4H2,1-2H3;1-2H3 |
| InChIKey | BAHGGOIREVPIAF-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|