C8H14O2S2 — CID 143150506
5,6-dimethyl-4-(sulfanylmethylsulfanyl)oxan-2-one (PubChem CID 143150506) has the molecular formula C8H14O2S2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 5,6-dimethyl-4-(sulfanylmethylsulfanyl)oxan-2-one.
| Compound Name | 5,6-dimethyl-4-(sulfanylmethylsulfanyl)oxan-2-one |
|---|---|
| PubChem CID | 143150506 |
| Molecular Formula | C8H14O2S2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 5,6-dimethyl-4-(sulfanylmethylsulfanyl)oxan-2-one |
| SMILES | CC1OC(=O)CC(SCS)C1C |
| InChI | InChI=1S/C8H14O2S2/c1-5-6(2)10-8(9)3-7(5)12-4-11/h5-7,11H,3-4H2,1-2H3 |
| InChIKey | UKWCYSXSMRFIDF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|