C10H11BrO2S — CID 118213964
4-bromo-5,6,7,8-tetrahydronaphthalene-1-sulfinic acid (PubChem CID 118213964) has the molecular formula C10H11BrO2S and a molecular weight of 275.17 g/mol. Its IUPAC name is 4-bromo-5,6,7,8-tetrahydronaphthalene-1-sulfinic acid.
| Compound Name | 4-bromo-5,6,7,8-tetrahydronaphthalene-1-sulfinic acid |
|---|---|
| PubChem CID | 118213964 |
| Molecular Formula | C10H11BrO2S |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 4-bromo-5,6,7,8-tetrahydronaphthalene-1-sulfinic acid |
| SMILES | O=S(O)c1ccc(Br)c2c1CCCC2 |
| InChI | InChI=1S/C10H11BrO2S/c11-9-5-6-10(14(12)13)8-4-2-1-3-7(8)9/h5-6H,1-4H2,(H,12,13) |
| InChIKey | PFNGAIJNUWLFCT-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|