C15H8Br2F6O6S2 — CID 123998633
4-bromo-3-[[6-bromo-3-sulfo-2-(trifluoromethyl)phenyl]methyl]-2-(trifluoromethyl)benzenesulfonic acid (PubChem CID 123998633) has the molecular formula C15H8Br2F6O6S2 and a molecular weight of 622.15 g/mol. Its IUPAC name is 4-bromo-3-[[6-bromo-3-sulfo-2-(trifluoromethyl)phenyl]methyl]-2-(trifluoromethyl)benzenesulfonic acid.
| Compound Name | 4-bromo-3-[[6-bromo-3-sulfo-2-(trifluoromethyl)phenyl]methyl]-2-(trifluoromethyl)benzenesulfonic acid |
|---|---|
| PubChem CID | 123998633 |
| Molecular Formula | C15H8Br2F6O6S2 |
| Molecular Weight | 622.15 g/mol |
| Exact Mass | 619.80 |
| IUPAC Name | 4-bromo-3-[[6-bromo-3-sulfo-2-(trifluoromethyl)phenyl]methyl]-2-(trifluoromethyl)benzenesulfonic acid |
| SMILES | O=S(=O)(O)c1ccc(Br)c(Cc2c(Br)ccc(S(=O)(=O)O)c2C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C15H8Br2F6O6S2/c16-8-1-3-10(30(24,25)26)12(14(18,19)20)6(8)5-7-9(17)2-4-11(31(27,28)29)13(7)15(21,22)23/h1-4H,5H2,(H,24,25,26)(H,27,28,29) |
| InChIKey | WXYHARFGJPXCJV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.15 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|