C21H16N8 — CID 118214061
N-(6-ethynyl-2-pyridinyl)-3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyrazin-5-amine (PubChem CID 118214061) has the molecular formula C21H16N8 and a molecular weight of 380.42 g/mol. Its IUPAC name is N-(6-ethynyl-2-pyridinyl)-3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyrazin-5-amine.
| Compound Name | N-(6-ethynyl-2-pyridinyl)-3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyrazin-5-amine |
|---|---|
| PubChem CID | 118214061 |
| Molecular Formula | C21H16N8 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N-(6-ethynyl-2-pyridinyl)-3-(quinolin-6-ylmethyl)-1,2-dihydrotriazolo[4,5-b]pyrazin-5-amine |
| SMILES | C#Cc1cccc(Nc2cnc3c(n2)N(Cc2ccc4ncccc4c2)NN3)n1 |
| InChI | InChI=1S/C21H16N8/c1-2-16-6-3-7-18(24-16)25-19-12-23-20-21(26-19)29(28-27-20)13-14-8-9-17-15(11-14)5-4-10-22-17/h1,3-12,28H,13H2,(H,23,27)(H,24,25,26) |
| InChIKey | GGFBHTOXWBRQAK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|