C23H37F2NO2 — CID 118214731
[(3R,5S,8R,9S,10S,13S,14S,17S)-3-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] N-(3-fluoropropyl)carbamate (PubChem CID 118214731) has the molecular formula C23H37F2NO2 and a molecular weight of 397.55 g/mol. Its IUPAC name is [(3R,5S,8R,9S,10S,13S,14S,17S)-3-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] N-(3-fluoropropyl)carbamate.
| Compound Name | [(3R,5S,8R,9S,10S,13S,14S,17S)-3-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] N-(3-fluoropropyl)carbamate |
|---|---|
| PubChem CID | 118214731 |
| Molecular Formula | C23H37F2NO2 |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.28 |
| IUPAC Name | [(3R,5S,8R,9S,10S,13S,14S,17S)-3-fluoro-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl] N-(3-fluoropropyl)carbamate |
| SMILES | C[C@]12CC[C@@H](F)C[C@@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC(=O)NCCCF)CC[C@@H]12 |
| InChI | InChI=1S/C23H37F2NO2/c1-22-10-8-16(25)14-15(22)4-5-17-18-6-7-20(23(18,2)11-9-19(17)22)28-21(27)26-13-3-12-24/h15-20H,3-14H2,1-2H3,(H,26,27)/t15-,16+,17-,18-,19-,20-,22-,23-/m0/s1 |
| InChIKey | RJQZNVQZOIGJQG-OYGOHLHNSA-N |
| XLogP | 5.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|