C19H19N5O — CID 118215004
(1-phenyl-5-pyridin-4-ylpyrazol-3-yl)-piperazin-1-ylmethanone (PubChem CID 118215004) has the molecular formula C19H19N5O and a molecular weight of 333.39 g/mol. Its IUPAC name is (1-phenyl-5-pyridin-4-ylpyrazol-3-yl)-piperazin-1-ylmethanone.
| Compound Name | (1-phenyl-5-pyridin-4-ylpyrazol-3-yl)-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 118215004 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (1-phenyl-5-pyridin-4-ylpyrazol-3-yl)-piperazin-1-ylmethanone |
| SMILES | O=C(c1cc(-c2ccncc2)n(-c2ccccc2)n1)N1CCNCC1 |
| InChI | InChI=1S/C19H19N5O/c25-19(23-12-10-21-11-13-23)17-14-18(15-6-8-20-9-7-15)24(22-17)16-4-2-1-3-5-16/h1-9,14,21H,10-13H2 |
| InChIKey | AAIVVJWKRGDKOZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |