C20H18ClFN4O — CID 45276620
[5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-piperazin-1-ylmethanone (PubChem CID 45276620) has the molecular formula C20H18ClFN4O and a molecular weight of 384.84 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-piperazin-1-ylmethanone.
| Compound Name | [5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 45276620 |
| Molecular Formula | C20H18ClFN4O |
| Molecular Weight | 384.84 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1cc(-c2ccc(Cl)cc2)n(-c2ccc(F)cc2)n1)N1CCNCC1 |
| InChI | InChI=1S/C20H18ClFN4O/c21-15-3-1-14(2-4-15)19-13-18(20(27)25-11-9-23-10-12-25)24-26(19)17-7-5-16(22)6-8-17/h1-8,13,23H,9-12H2 |
| InChIKey | YNIBFQFRPICJDT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.84 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |