C23H20ClFN4O — CID 45277095
[5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-(4-prop-2-ynylpiperazin-1-yl)methanone (PubChem CID 45277095) has the molecular formula C23H20ClFN4O and a molecular weight of 422.89 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-(4-prop-2-ynylpiperazin-1-yl)methanone.
| Compound Name | [5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-(4-prop-2-ynylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 45277095 |
| Molecular Formula | C23H20ClFN4O |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | [5-(4-chlorophenyl)-1-(4-fluorophenyl)pyrazol-3-yl]-(4-prop-2-ynylpiperazin-1-yl)methanone |
| SMILES | C#CCN1CCN(C(=O)c2cc(-c3ccc(Cl)cc3)n(-c3ccc(F)cc3)n2)CC1 |
| InChI | InChI=1S/C23H20ClFN4O/c1-2-11-27-12-14-28(15-13-27)23(30)21-16-22(17-3-5-18(24)6-4-17)29(26-21)20-9-7-19(25)8-10-20/h1,3-10,16H,11-15H2 |
| InChIKey | RLCZDBWKEFWVAI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|