About 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid
6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid (PubChem CID 118217461) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid.
Analyze 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid?
The IUPAC name of 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid (CID 118217461) is 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid.
What is the SMILES notation for 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid?
The canonical SMILES for 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid is CC(C)(C)C(=O)C1CC2(CC(C(=O)O)C2)C1.
What is the InChIKey of 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid?
The InChIKey is LWIHXDXZBRWNSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3/c1-12(2,3)10(14)8-4-13(5-8)6-9(7-13)11(15)16/h8-9H,4-7H2,1-3H3,(H,15,16).
What are the key properties of 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid?
6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid has a molecular weight of 224.30 g/mol, XLogP of 2.49, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-dimethylpropanoyl)spiro[3.3]heptane-2-carboxylic acid is sourced from PubChem (CID 118217461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).