C17H30O — CID 160987153
1-[4-(3,3-dimethylbut-1-en-2-yl)cyclohexyl]-2,2-dimethylpropan-1-one (PubChem CID 160987153) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-[4-(3,3-dimethylbut-1-en-2-yl)cyclohexyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[4-(3,3-dimethylbut-1-en-2-yl)cyclohexyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 160987153 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 1-[4-(3,3-dimethylbut-1-en-2-yl)cyclohexyl]-2,2-dimethylpropan-1-one |
| SMILES | C=C(C1CCC(C(=O)C(C)(C)C)CC1)C(C)(C)C |
| InChI | InChI=1S/C17H30O/c1-12(16(2,3)4)13-8-10-14(11-9-13)15(18)17(5,6)7/h13-14H,1,8-11H2,2-7H3 |
| InChIKey | TUCXOGSNYJEOKX-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|