C16H24N2O — CID 174326681
1-(1-aminopiperidin-4-yl)-2,2-dimethylpropan-1-one;bicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 174326681) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(1-aminopiperidin-4-yl)-2,2-dimethylpropan-1-one;bicyclo[2.2.0]hexa-1,3,5-triene.
| Compound Name | 1-(1-aminopiperidin-4-yl)-2,2-dimethylpropan-1-one;bicyclo[2.2.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 174326681 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-(1-aminopiperidin-4-yl)-2,2-dimethylpropan-1-one;bicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | CC(C)(C)C(=O)C1CCN(N)CC1.c1cc2ccc1-2 |
| InChI | InChI=1S/C10H20N2O.C6H4/c1-10(2,3)9(13)8-4-6-12(11)7-5-8;1-2-6-4-3-5(1)6/h8H,4-7,11H2,1-3H3;1-4H |
| InChIKey | UACUCOSBGRXEBW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|