C6H10ClF3N2O — CID 70368268
1-[(3S)-1-aminopyrrolidin-3-yl]-2,2,2-trifluoroethanone;hydrochloride (PubChem CID 70368268) has the molecular formula C6H10ClF3N2O and a molecular weight of 218.61 g/mol. Its IUPAC name is 1-[(3S)-1-aminopyrrolidin-3-yl]-2,2,2-trifluoroethanone;hydrochloride.
| Compound Name | 1-[(3S)-1-aminopyrrolidin-3-yl]-2,2,2-trifluoroethanone;hydrochloride |
|---|---|
| PubChem CID | 70368268 |
| Molecular Formula | C6H10ClF3N2O |
| Molecular Weight | 218.61 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 1-[(3S)-1-aminopyrrolidin-3-yl]-2,2,2-trifluoroethanone;hydrochloride |
| SMILES | Cl.NN1CC[C@H](C(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C6H9F3N2O.ClH/c7-6(8,9)5(12)4-1-2-11(10)3-4;/h4H,1-3,10H2;1H/t4-;/m0./s1 |
| InChIKey | VDMNWMILPKGKCO-WCCKRBBISA-N |
| XLogP | 0.74 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.61 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|