C42H29N2O2PS — CID 118219845
2-methyl-6-[4-[16-[4-(6-methyl-2-pyridinyl)phenyl]-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaen-6-yl]phenyl]pyridine (PubChem CID 118219845) has the molecular formula C42H29N2O2PS and a molecular weight of 656.75 g/mol. Its IUPAC name is 2-methyl-6-[4-[16-[4-(6-methyl-2-pyridinyl)phenyl]-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaen-6-yl]phenyl]pyridine.
| Compound Name | 2-methyl-6-[4-[16-[4-(6-methyl-2-pyridinyl)phenyl]-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaen-6-yl]phenyl]pyridine |
|---|---|
| PubChem CID | 118219845 |
| Molecular Formula | C42H29N2O2PS |
| Molecular Weight | 656.75 g/mol |
| Exact Mass | 656.17 |
| IUPAC Name | 2-methyl-6-[4-[16-[4-(6-methyl-2-pyridinyl)phenyl]-1-sulfanylidene-8,14-dioxa-1λ5-phosphapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2,4,6,9(21),10,12,15,17,19-nonaen-6-yl]phenyl]pyridine |
| SMILES | Cc1cccc(-c2ccc(-c3cccc4c3Oc3cccc5c3P4(=S)c3cccc(-c4ccc(-c6cccc(C)n6)cc4)c3O5)cc2)n1 |
| InChI | InChI=1S/C42H29N2O2PS/c1-26-8-3-12-34(43-26)30-22-18-28(19-23-30)32-10-5-16-38-40(32)45-36-14-7-15-37-42(36)47(38,48)39-17-6-11-33(41(39)46-37)29-20-24-31(25-21-29)35-13-4-9-27(2)44-35/h3-25H,1-2H3 |
| InChIKey | QWLFAFKPSNXDPJ-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.75 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|