C19H21NO — CID 11821988
5-methyl-5-phenyl-3-(3-phenylpropyl)-4H-1,2-oxazole (PubChem CID 11821988) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 5-methyl-5-phenyl-3-(3-phenylpropyl)-4H-1,2-oxazole.
| Compound Name | 5-methyl-5-phenyl-3-(3-phenylpropyl)-4H-1,2-oxazole |
|---|---|
| PubChem CID | 11821988 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 5-methyl-5-phenyl-3-(3-phenylpropyl)-4H-1,2-oxazole |
| SMILES | CC1(c2ccccc2)CC(CCCc2ccccc2)=NO1 |
| InChI | InChI=1S/C19H21NO/c1-19(17-12-6-3-7-13-17)15-18(20-21-19)14-8-11-16-9-4-2-5-10-16/h2-7,9-10,12-13H,8,11,14-15H2,1H3 |
| InChIKey | ZNPHJIGBWKXMGP-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |