C32H30ClF2N2O8PS — CID 118222090
dibenzyl [4-[5-[(3-chloro-4-fluorophenyl)carbamoyl]-2-fluorophenyl]sulfonyl-1,4-oxazepan-6-yl] phosphate (PubChem CID 118222090) has the molecular formula C32H30ClF2N2O8PS and a molecular weight of 707.09 g/mol. Its IUPAC name is dibenzyl [4-[5-[(3-chloro-4-fluorophenyl)carbamoyl]-2-fluorophenyl]sulfonyl-1,4-oxazepan-6-yl] phosphate.
| Compound Name | dibenzyl [4-[5-[(3-chloro-4-fluorophenyl)carbamoyl]-2-fluorophenyl]sulfonyl-1,4-oxazepan-6-yl] phosphate |
|---|---|
| PubChem CID | 118222090 |
| Molecular Formula | C32H30ClF2N2O8PS |
| Molecular Weight | 707.09 g/mol |
| Exact Mass | 706.11 |
| IUPAC Name | dibenzyl [4-[5-[(3-chloro-4-fluorophenyl)carbamoyl]-2-fluorophenyl]sulfonyl-1,4-oxazepan-6-yl] phosphate |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1ccc(F)c(S(=O)(=O)N2CCOCC(OP(=O)(OCc3ccccc3)OCc3ccccc3)C2)c1 |
| InChI | InChI=1S/C32H30ClF2N2O8PS/c33-28-18-26(12-14-29(28)34)36-32(38)25-11-13-30(35)31(17-25)47(40,41)37-15-16-42-22-27(19-37)45-46(39,43-20-23-7-3-1-4-8-23)44-21-24-9-5-2-6-10-24/h1-14,17-18,27H,15-16,19-22H2,(H,36,38) |
| InChIKey | TXARZDMVOADYLT-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.09 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|