C18H18ClF2N2O8PS — CID 118222087
[4-[5-[(3-chloro-4-fluorophenyl)carbamoyl]-2-fluorophenyl]sulfonyl-1,4-oxazepan-6-yl] dihydrogen phosphate (PubChem CID 118222087) has the molecular formula C18H18ClF2N2O8PS and a molecular weight of 526.84 g/mol. Its IUPAC name is [4-[5-[(3-chloro-4-fluorophenyl)carbamoyl]-2-fluorophenyl]sulfonyl-1,4-oxazepan-6-yl] dihydrogen phosphate.
| Compound Name | [4-[5-[(3-chloro-4-fluorophenyl)carbamoyl]-2-fluorophenyl]sulfonyl-1,4-oxazepan-6-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 118222087 |
| Molecular Formula | C18H18ClF2N2O8PS |
| Molecular Weight | 526.84 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | [4-[5-[(3-chloro-4-fluorophenyl)carbamoyl]-2-fluorophenyl]sulfonyl-1,4-oxazepan-6-yl] dihydrogen phosphate |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)c1ccc(F)c(S(=O)(=O)N2CCOCC(OP(=O)(O)O)C2)c1 |
| InChI | InChI=1S/C18H18ClF2N2O8PS/c19-14-8-12(2-4-15(14)20)22-18(24)11-1-3-16(21)17(7-11)33(28,29)23-5-6-30-10-13(9-23)31-32(25,26)27/h1-4,7-8,13H,5-6,9-10H2,(H,22,24)(H2,25,26,27) |
| InChIKey | ZYZKANMCVHNQFQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.84 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|