C21H17FO3S — CID 118222180
methyl 2-[5-[2-(4-fluorophenyl)acetyl]-2-phenylthiophen-3-yl]acetate (PubChem CID 118222180) has the molecular formula C21H17FO3S and a molecular weight of 368.43 g/mol. Its IUPAC name is methyl 2-[5-[2-(4-fluorophenyl)acetyl]-2-phenylthiophen-3-yl]acetate.
| Compound Name | methyl 2-[5-[2-(4-fluorophenyl)acetyl]-2-phenylthiophen-3-yl]acetate |
|---|---|
| PubChem CID | 118222180 |
| Molecular Formula | C21H17FO3S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | methyl 2-[5-[2-(4-fluorophenyl)acetyl]-2-phenylthiophen-3-yl]acetate |
| SMILES | COC(=O)Cc1cc(C(=O)Cc2ccc(F)cc2)sc1-c1ccccc1 |
| InChI | InChI=1S/C21H17FO3S/c1-25-20(24)13-16-12-19(26-21(16)15-5-3-2-4-6-15)18(23)11-14-7-9-17(22)10-8-14/h2-10,12H,11,13H2,1H3 |
| InChIKey | JPWANXBCZDZKIH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |