C29H33N7O — CID 118224984
5-cyclopropyl-N-methyl-2-[2-(2-phenoxyethylamino)-4-pyridinyl]-N-piperidin-4-ylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 118224984) has the molecular formula C29H33N7O and a molecular weight of 495.63 g/mol. Its IUPAC name is 5-cyclopropyl-N-methyl-2-[2-(2-phenoxyethylamino)-4-pyridinyl]-N-piperidin-4-ylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 5-cyclopropyl-N-methyl-2-[2-(2-phenoxyethylamino)-4-pyridinyl]-N-piperidin-4-ylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118224984 |
| Molecular Formula | C29H33N7O |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 5-cyclopropyl-N-methyl-2-[2-(2-phenoxyethylamino)-4-pyridinyl]-N-piperidin-4-ylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CN(c1nc(-c2ccnc(NCCOc3ccccc3)c2)nc2cncc(C3CC3)c12)C1CCNCC1 |
| InChI | InChI=1S/C29H33N7O/c1-36(22-10-12-30-13-11-22)29-27-24(20-7-8-20)18-31-19-25(27)34-28(35-29)21-9-14-32-26(17-21)33-15-16-37-23-5-3-2-4-6-23/h2-6,9,14,17-20,22,30H,7-8,10-13,15-16H2,1H3,(H,32,33) |
| InChIKey | DVRVTZQSQBOSTA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|