C52H39N5S — CID 118228086
6-[3-[4-[4-(1,2-dihydropyridin-4-yl)phenyl]-6-pyridin-4-yl-1,2,3,4-tetrahydropyrimidin-2-yl]phenyl]-2,3-diphenylthieno[3,2-c]carbazole (PubChem CID 118228086) has the molecular formula C52H39N5S and a molecular weight of 765.99 g/mol. Its IUPAC name is 6-[3-[4-[4-(1,2-dihydropyridin-4-yl)phenyl]-6-pyridin-4-yl-1,2,3,4-tetrahydropyrimidin-2-yl]phenyl]-2,3-diphenylthieno[3,2-c]carbazole.
| Compound Name | 6-[3-[4-[4-(1,2-dihydropyridin-4-yl)phenyl]-6-pyridin-4-yl-1,2,3,4-tetrahydropyrimidin-2-yl]phenyl]-2,3-diphenylthieno[3,2-c]carbazole |
|---|---|
| PubChem CID | 118228086 |
| Molecular Formula | C52H39N5S |
| Molecular Weight | 765.99 g/mol |
| Exact Mass | 765.29 |
| IUPAC Name | 6-[3-[4-[4-(1,2-dihydropyridin-4-yl)phenyl]-6-pyridin-4-yl-1,2,3,4-tetrahydropyrimidin-2-yl]phenyl]-2,3-diphenylthieno[3,2-c]carbazole |
| SMILES | C1=CC(c2ccc(C3C=C(c4ccncc4)NC(c4cccc(-n5c6ccccc6c6c7sc(-c8ccccc8)c(-c8ccccc8)c7ccc65)c4)N3)cc2)=CCN1 |
| InChI | InChI=1S/C52H39N5S/c1-3-10-38(11-4-1)48-43-22-23-47-49(51(43)58-50(48)39-12-5-2-6-13-39)42-16-7-8-17-46(42)57(47)41-15-9-14-40(32-41)52-55-44(33-45(56-52)37-26-30-54-31-27-37)36-20-18-34(19-21-36)35-24-28-53-29-25-35/h1-28,30-33,44,52-53,55-56H,29H2 |
| InChIKey | KHPCWGOSHFFGLQ-UHFFFAOYSA-N |
| XLogP | 12.20 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.99 |
| LogP ≤ 5 | 12.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |