C44H35N7O — CID 134390813
6-[3-[4-[4-(1,2-dihydropyridin-4-yl)phenyl]-2-pyridin-4-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl]phenyl]-2-phenyl-2,3-dihydro-[1,3]oxazolo[4,5-c]carbazole (PubChem CID 134390813) has the molecular formula C44H35N7O and a molecular weight of 677.81 g/mol. Its IUPAC name is 6-[3-[4-[4-(1,2-dihydropyridin-4-yl)phenyl]-2-pyridin-4-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl]phenyl]-2-phenyl-2,3-dihydro-[1,3]oxazolo[4,5-c]carbazole.
| Compound Name | 6-[3-[4-[4-(1,2-dihydropyridin-4-yl)phenyl]-2-pyridin-4-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl]phenyl]-2-phenyl-2,3-dihydro-[1,3]oxazolo[4,5-c]carbazole |
|---|---|
| PubChem CID | 134390813 |
| Molecular Formula | C44H35N7O |
| Molecular Weight | 677.81 g/mol |
| Exact Mass | 677.29 |
| IUPAC Name | 6-[3-[4-[4-(1,2-dihydropyridin-4-yl)phenyl]-2-pyridin-4-yl-1,2,3,4-tetrahydro-1,3,5-triazin-6-yl]phenyl]-2-phenyl-2,3-dihydro-[1,3]oxazolo[4,5-c]carbazole |
| SMILES | C1=CC(c2ccc(C3N=C(c4cccc(-n5c6ccccc6c6c7c(ccc65)NC(c5ccccc5)O7)c4)NC(c4ccncc4)N3)cc2)=CCN1 |
| InChI | InChI=1S/C44H35N7O/c1-2-7-32(8-3-1)44-47-36-17-18-38-39(40(36)52-44)35-11-4-5-12-37(35)51(38)34-10-6-9-33(27-34)43-49-41(48-42(50-43)31-21-25-46-26-22-31)30-15-13-28(14-16-30)29-19-23-45-24-20-29/h1-23,25-27,41-42,44-45,47-48H,24H2,(H,49,50) |
| InChIKey | FBFUOJUEEDYIKZ-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 87.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.81 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |