C42H29N3O — CID 118228107
6-[3-(1,2-dihydropyridin-3-yl)-5-pyridin-3-ylphenyl]-2,3-diphenylfuro[3,2-c]carbazole (PubChem CID 118228107) has the molecular formula C42H29N3O and a molecular weight of 591.71 g/mol. Its IUPAC name is 6-[3-(1,2-dihydropyridin-3-yl)-5-pyridin-3-ylphenyl]-2,3-diphenylfuro[3,2-c]carbazole.
| Compound Name | 6-[3-(1,2-dihydropyridin-3-yl)-5-pyridin-3-ylphenyl]-2,3-diphenylfuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 118228107 |
| Molecular Formula | C42H29N3O |
| Molecular Weight | 591.71 g/mol |
| Exact Mass | 591.23 |
| IUPAC Name | 6-[3-(1,2-dihydropyridin-3-yl)-5-pyridin-3-ylphenyl]-2,3-diphenylfuro[3,2-c]carbazole |
| SMILES | C1=CNCC(c2cc(-c3cccnc3)cc(-n3c4ccccc4c4c5oc(-c6ccccc6)c(-c6ccccc6)c5ccc43)c2)=C1 |
| InChI | InChI=1S/C42H29N3O/c1-3-11-28(12-4-1)39-36-19-20-38-40(42(36)46-41(39)29-13-5-2-6-14-29)35-17-7-8-18-37(35)45(38)34-24-32(30-15-9-21-43-26-30)23-33(25-34)31-16-10-22-44-27-31/h1-26,44H,27H2 |
| InChIKey | DPKMEMQIUQFVBA-UHFFFAOYSA-N |
| XLogP | 10.43 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.71 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |