C34H21N5S — CID 118229357
6-[3-(2,6-dipyridin-4-ylpyrimidin-4-yl)phenyl]thieno[3,2-c]carbazole (PubChem CID 118229357) has the molecular formula C34H21N5S and a molecular weight of 531.64 g/mol. Its IUPAC name is 6-[3-(2,6-dipyridin-4-ylpyrimidin-4-yl)phenyl]thieno[3,2-c]carbazole.
| Compound Name | 6-[3-(2,6-dipyridin-4-ylpyrimidin-4-yl)phenyl]thieno[3,2-c]carbazole |
|---|---|
| PubChem CID | 118229357 |
| Molecular Formula | C34H21N5S |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | 6-[3-(2,6-dipyridin-4-ylpyrimidin-4-yl)phenyl]thieno[3,2-c]carbazole |
| SMILES | c1cc(-c2cc(-c3ccncc3)nc(-c3ccncc3)n2)cc(-n2c3ccccc3c3c4sccc4ccc32)c1 |
| InChI | InChI=1S/C34H21N5S/c1-2-7-30-27(6-1)32-31(9-8-23-14-19-40-33(23)32)39(30)26-5-3-4-25(20-26)29-21-28(22-10-15-35-16-11-22)37-34(38-29)24-12-17-36-18-13-24/h1-21H |
| InChIKey | QBLTZUQNHHJWAQ-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |