C39H24N6S — CID 118229504
6-[3-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]-2-phenylthieno[3,2-c]carbazole (PubChem CID 118229504) has the molecular formula C39H24N6S and a molecular weight of 608.73 g/mol. Its IUPAC name is 6-[3-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]-2-phenylthieno[3,2-c]carbazole.
| Compound Name | 6-[3-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]-2-phenylthieno[3,2-c]carbazole |
|---|---|
| PubChem CID | 118229504 |
| Molecular Formula | C39H24N6S |
| Molecular Weight | 608.73 g/mol |
| Exact Mass | 608.18 |
| IUPAC Name | 6-[3-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]-2-phenylthieno[3,2-c]carbazole |
| SMILES | c1ccc(-c2cc3ccc4c(c5ccccc5n4-c4cccc(-c5nc(-c6ccncc6)nc(-c6ccncc6)n5)c4)c3s2)cc1 |
| InChI | InChI=1S/C39H24N6S/c1-2-7-25(8-3-1)34-24-28-13-14-33-35(36(28)46-34)31-11-4-5-12-32(31)45(33)30-10-6-9-29(23-30)39-43-37(26-15-19-40-20-16-26)42-38(44-39)27-17-21-41-22-18-27/h1-24H |
| InChIKey | FJHVOZOVSCUCLR-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.73 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |