About 3-methyl-1,4-oxazepan-6-ol
3-methyl-1,4-oxazepan-6-ol (PubChem CID 118230390) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is 3-methyl-1,4-oxazepan-6-ol.
Molecular Properties
| Compound Name | 3-methyl-1,4-oxazepan-6-ol |
| PubChem CID | 118230390 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 3-methyl-1,4-oxazepan-6-ol |
| SMILES | CC1COCC(O)CN1 |
| InChI | InChI=1S/C6H13NO2/c1-5-3-9-4-6(8)2-7-5/h5-8H,2-4H2,1H3 |
| InChIKey | JGWJKPUJJVVQGV-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-1,4-oxazepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,4-oxazepan-6-ol?
The IUPAC name of 3-methyl-1,4-oxazepan-6-ol (CID 118230390) is 3-methyl-1,4-oxazepan-6-ol.
What is the SMILES notation for 3-methyl-1,4-oxazepan-6-ol?
The canonical SMILES for 3-methyl-1,4-oxazepan-6-ol is CC1COCC(O)CN1.
What is the InChIKey of 3-methyl-1,4-oxazepan-6-ol?
The InChIKey is JGWJKPUJJVVQGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-5-3-9-4-6(8)2-7-5/h5-8H,2-4H2,1H3.
What are the key properties of 3-methyl-1,4-oxazepan-6-ol?
3-methyl-1,4-oxazepan-6-ol has a molecular weight of 131.18 g/mol, XLogP of -0.64, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,4-oxazepan-6-ol is sourced from PubChem (CID 118230390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).