C27H35FN2O5S — CID 118232497
4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-N-(2-methoxyethyl)oxane-4-carboxamide (PubChem CID 118232497) has the molecular formula C27H35FN2O5S and a molecular weight of 518.65 g/mol. Its IUPAC name is 4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-N-(2-methoxyethyl)oxane-4-carboxamide.
| Compound Name | 4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-N-(2-methoxyethyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 118232497 |
| Molecular Formula | C27H35FN2O5S |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.23 |
| IUPAC Name | 4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-N-(2-methoxyethyl)oxane-4-carboxamide |
| SMILES | COCCNC(=O)C1(c2ccc(CN3[C@@H](C)CC[C@H](c4ccccc4)S3(=O)=O)c(F)c2)CCOCC1 |
| InChI | InChI=1S/C27H35FN2O5S/c1-20-8-11-25(21-6-4-3-5-7-21)36(32,33)30(20)19-22-9-10-23(18-24(22)28)27(12-15-35-16-13-27)26(31)29-14-17-34-2/h3-7,9-10,18,20,25H,8,11-17,19H2,1-2H3,(H,29,31)/t20-,25+/m0/s1 |
| InChIKey | BDBGFNPHWAPRRH-NBGIEHNGSA-N |
| XLogP | 3.69 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|