C27H32FN3O4S — CID 118232498
N-(2-cyanoethyl)-4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]oxane-4-carboxamide (PubChem CID 118232498) has the molecular formula C27H32FN3O4S and a molecular weight of 513.64 g/mol. Its IUPAC name is N-(2-cyanoethyl)-4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]oxane-4-carboxamide.
| Compound Name | N-(2-cyanoethyl)-4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]oxane-4-carboxamide |
|---|---|
| PubChem CID | 118232498 |
| Molecular Formula | C27H32FN3O4S |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.21 |
| IUPAC Name | N-(2-cyanoethyl)-4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]oxane-4-carboxamide |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)S(=O)(=O)N1Cc1ccc(C2(C(=O)NCCC#N)CCOCC2)cc1F |
| InChI | InChI=1S/C27H32FN3O4S/c1-20-8-11-25(21-6-3-2-4-7-21)36(33,34)31(20)19-22-9-10-23(18-24(22)28)27(12-16-35-17-13-27)26(32)30-15-5-14-29/h2-4,6-7,9-10,18,20,25H,5,8,11-13,15-17,19H2,1H3,(H,30,32)/t20-,25+/m0/s1 |
| InChIKey | GOVMWGJKBCCVHM-NBGIEHNGSA-N |
| XLogP | 3.96 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|