C20H30O3 — CID 11823305
(3R,3aS,5aS,6R,7R,8aS,8bR)-3-(2,2-dimethoxyethyl)-6-ethyl-7-methyl-3,3a,5a,6,7,8,8a,8b-octahydro-as-indacene-2-carbaldehyde (PubChem CID 11823305) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (3R,3aS,5aS,6R,7R,8aS,8bR)-3-(2,2-dimethoxyethyl)-6-ethyl-7-methyl-3,3a,5a,6,7,8,8a,8b-octahydro-as-indacene-2-carbaldehyde.
| Compound Name | (3R,3aS,5aS,6R,7R,8aS,8bR)-3-(2,2-dimethoxyethyl)-6-ethyl-7-methyl-3,3a,5a,6,7,8,8a,8b-octahydro-as-indacene-2-carbaldehyde |
|---|---|
| PubChem CID | 11823305 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (3R,3aS,5aS,6R,7R,8aS,8bR)-3-(2,2-dimethoxyethyl)-6-ethyl-7-methyl-3,3a,5a,6,7,8,8a,8b-octahydro-as-indacene-2-carbaldehyde |
| SMILES | CC[C@H]1[C@@H]2C=C[C@H]3[C@H](C=C(C=O)[C@@H]3CC(OC)OC)[C@H]2C[C@H]1C |
| InChI | InChI=1S/C20H30O3/c1-5-14-12(2)8-18-15(14)6-7-16-17(10-20(22-3)23-4)13(11-21)9-19(16)18/h6-7,9,11-12,14-20H,5,8,10H2,1-4H3/t12-,14-,15+,16-,17+,18+,19+/m1/s1 |
| InChIKey | BRMBUKGPXCYSDS-KOXHIAQUSA-N |
| XLogP | 3.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|