C20H32O3 — CID 10892568
(2R,3R,3aS,5aS,6R,7R,8aR,8bR)-3-(2,2-dimethoxyethyl)-6-ethyl-7-methyl-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-2-carbaldehyde (PubChem CID 10892568) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (2R,3R,3aS,5aS,6R,7R,8aR,8bR)-3-(2,2-dimethoxyethyl)-6-ethyl-7-methyl-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-2-carbaldehyde.
| Compound Name | (2R,3R,3aS,5aS,6R,7R,8aR,8bR)-3-(2,2-dimethoxyethyl)-6-ethyl-7-methyl-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-2-carbaldehyde |
|---|---|
| PubChem CID | 10892568 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (2R,3R,3aS,5aS,6R,7R,8aR,8bR)-3-(2,2-dimethoxyethyl)-6-ethyl-7-methyl-1,2,3,3a,5a,6,7,8,8a,8b-decahydro-as-indacene-2-carbaldehyde |
| SMILES | CC[C@H]1[C@@H]2C=C[C@@H]3[C@@H](CC(OC)OC)[C@H](C=O)C[C@@H]3[C@H]2C[C@H]1C |
| InChI | InChI=1S/C20H32O3/c1-5-14-12(2)8-18-15(14)6-7-16-17(10-20(22-3)23-4)13(11-21)9-19(16)18/h6-7,11-20H,5,8-10H2,1-4H3/t12-,13+,14-,15+,16-,17+,18+,19+/m1/s1 |
| InChIKey | LCNAYEAVKNBUQS-JXFZAIEBSA-N |
| XLogP | 3.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|