C46H80N2O6 — CID 118233157
[(3R,7S,8S)-8-[(3S,5R)-3,5-dihydroxy-7-[2-[methyl-[(Z)-octadec-9-enoyl]amino]ethylamino]-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 118233157) has the molecular formula C46H80N2O6 and a molecular weight of 757.15 g/mol. Its IUPAC name is [(3R,7S,8S)-8-[(3S,5R)-3,5-dihydroxy-7-[2-[methyl-[(Z)-octadec-9-enoyl]amino]ethylamino]-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(3R,7S,8S)-8-[(3S,5R)-3,5-dihydroxy-7-[2-[methyl-[(Z)-octadec-9-enoyl]amino]ethylamino]-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 118233157 |
| Molecular Formula | C46H80N2O6 |
| Molecular Weight | 757.15 g/mol |
| Exact Mass | 756.60 |
| IUPAC Name | [(3R,7S,8S)-8-[(3S,5R)-3,5-dihydroxy-7-[2-[methyl-[(Z)-octadec-9-enoyl]amino]ethylamino]-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N(C)CCNC(=O)C[C@H](O)C[C@@H](O)CC[C@@H]1C2C(=C[C@H](C)CC2OC(=O)C(C)(C)CC)C=C[C@@H]1C |
| InChI | InChI=1S/C46H80N2O6/c1-8-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-43(52)48(7)30-29-47-42(51)34-39(50)33-38(49)27-28-40-36(4)25-26-37-31-35(3)32-41(44(37)40)54-45(53)46(5,6)9-2/h16-17,25-26,31,35-36,38-41,44,49-50H,8-15,18-24,27-30,32-34H2,1-7H3,(H,47,51)/b17-16-/t35-,36-,38-,39+,40-,41?,44?/m0/s1 |
| InChIKey | PUTFSNNGJSYNRX-WPHCZJBUSA-N |
| XLogP | 9.63 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.15 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|