C47H80N2O6 — CID 140680337
[(3R,7S,8S)-8-[(3S,5R)-3,5-dihydroxy-7-[[(3S)-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl]amino]-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate (PubChem CID 140680337) has the molecular formula C47H80N2O6 and a molecular weight of 769.16 g/mol. Its IUPAC name is [(3R,7S,8S)-8-[(3S,5R)-3,5-dihydroxy-7-[[(3S)-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl]amino]-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate.
| Compound Name | [(3R,7S,8S)-8-[(3S,5R)-3,5-dihydroxy-7-[[(3S)-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl]amino]-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 140680337 |
| Molecular Formula | C47H80N2O6 |
| Molecular Weight | 769.16 g/mol |
| Exact Mass | 768.60 |
| IUPAC Name | [(3R,7S,8S)-8-[(3S,5R)-3,5-dihydroxy-7-[[(3S)-1-[(Z)-octadec-9-enoyl]pyrrolidin-3-yl]amino]-7-oxoheptyl]-3,7-dimethyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] 2,2-dimethylbutanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N1CC[C@H](NC(=O)C[C@H](O)C[C@@H](O)CC[C@@H]2C3C(=C[C@H](C)CC3OC(=O)C(C)(C)CC)C=C[C@@H]2C)C1 |
| InChI | InChI=1S/C47H80N2O6/c1-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-44(53)49-29-28-38(34-49)48-43(52)33-40(51)32-39(50)26-27-41-36(4)24-25-37-30-35(3)31-42(45(37)41)55-46(54)47(5,6)8-2/h15-16,24-25,30,35-36,38-42,45,50-51H,7-14,17-23,26-29,31-34H2,1-6H3,(H,48,52)/b16-15-/t35-,36-,38-,39-,40+,41-,42?,45?/m0/s1 |
| InChIKey | QPZHGUUMKFIZAG-CIODYLOWSA-N |
| XLogP | 9.78 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.16 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|