C13H25NO6Si — CID 11823345
(5S,6S,7R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7,8-dihydroxy-1,10-dioxa-3-azaspiro[4.5]decan-2-one (PubChem CID 11823345) has the molecular formula C13H25NO6Si and a molecular weight of 319.43 g/mol. Its IUPAC name is (5S,6S,7R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7,8-dihydroxy-1,10-dioxa-3-azaspiro[4.5]decan-2-one.
| Compound Name | (5S,6S,7R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7,8-dihydroxy-1,10-dioxa-3-azaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 11823345 |
| Molecular Formula | C13H25NO6Si |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | (5S,6S,7R,8R)-6-[tert-butyl(dimethyl)silyl]oxy-7,8-dihydroxy-1,10-dioxa-3-azaspiro[4.5]decan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](O)CO[C@]12CNC(=O)O2 |
| InChI | InChI=1S/C13H25NO6Si/c1-12(2,3)21(4,5)20-10-9(16)8(15)6-18-13(10)7-14-11(17)19-13/h8-10,15-16H,6-7H2,1-5H3,(H,14,17)/t8-,9-,10+,13+/m1/s1 |
| InChIKey | LTVIDTHKROSLAA-DNJQJEMRSA-N |
| XLogP | 0.56 |
| TPSA | 97.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|