C18H33NO6Si — CID 58766081
(3'aR,5S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-diethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one (PubChem CID 58766081) has the molecular formula C18H33NO6Si and a molecular weight of 387.55 g/mol. Its IUPAC name is (3'aR,5S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-diethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one.
| Compound Name | (3'aR,5S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-diethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one |
|---|---|
| PubChem CID | 58766081 |
| Molecular Formula | C18H33NO6Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | (3'aR,5S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-diethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one |
| SMILES | CCC1(CC)OC2[C@@H](CO[C@]3(CNC(=O)O3)[C@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C18H33NO6Si/c1-8-17(9-2)22-12-10-21-18(11-19-15(20)24-18)14(13(12)23-17)25-26(6,7)16(3,4)5/h12-14H,8-11H2,1-7H3,(H,19,20)/t12-,13?,14+,18+/m1/s1 |
| InChIKey | ORWADXOWGYSJNA-VRIOJTOSSA-N |
| XLogP | 3.14 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|