C16H29NO6Si — CID 58766040
(3'aR,4S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole]-2'-one (PubChem CID 58766040) has the molecular formula C16H29NO6Si and a molecular weight of 359.50 g/mol. Its IUPAC name is (3'aR,4S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole]-2'-one.
| Compound Name | (3'aR,4S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole]-2'-one |
|---|---|
| PubChem CID | 58766040 |
| Molecular Formula | C16H29NO6Si |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (3'aR,4S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydro-3H-pyrano[3,4-d][1,3]oxazole]-2'-one |
| SMILES | CC1(C)OC[C@]2(OC[C@H]3NC(=O)OC3[C@@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H29NO6Si/c1-14(2,3)24(6,7)22-12-11-10(17-13(18)21-11)8-19-16(12)9-20-15(4,5)23-16/h10-12H,8-9H2,1-7H3,(H,17,18)/t10-,11?,12+,16+/m1/s1 |
| InChIKey | IQNLSZVMGZLGJQ-BICJHPMVSA-N |
| XLogP | 2.36 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|