C22H41NO7Si — CID 10766358
tri(propan-2-yl)silyl N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]carbamate (PubChem CID 10766358) has the molecular formula C22H41NO7Si and a molecular weight of 459.66 g/mol. Its IUPAC name is tri(propan-2-yl)silyl N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]carbamate.
| Compound Name | tri(propan-2-yl)silyl N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]carbamate |
|---|---|
| PubChem CID | 10766358 |
| Molecular Formula | C22H41NO7Si |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.27 |
| IUPAC Name | tri(propan-2-yl)silyl N-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]carbamate |
| SMILES | CC(C)[Si](OC(=O)NC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]2OC(C)(C)O[C@H]21)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H41NO7Si/c1-12(2)31(13(3)4,14(5)6)30-20(24)23-11-15-16-17(27-21(7,8)26-16)18-19(25-15)29-22(9,10)28-18/h12-19H,11H2,1-10H3,(H,23,24)/t15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | HKEFHLMNRKTXHA-ICBNADEASA-N |
| XLogP | 4.28 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|