C16H31NO5Si — CID 23240036
N-[(3aR,4S,6S,6aR)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]formamide (PubChem CID 23240036) has the molecular formula C16H31NO5Si and a molecular weight of 345.51 g/mol. Its IUPAC name is N-[(3aR,4S,6S,6aR)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]formamide.
| Compound Name | N-[(3aR,4S,6S,6aR)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]formamide |
|---|---|
| PubChem CID | 23240036 |
| Molecular Formula | C16H31NO5Si |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N-[(3aR,4S,6S,6aR)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]formamide |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[C@H](NC=O)[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C16H31NO5Si/c1-10(22-23(7,8)15(2,3)4)11-12-13(14(19-11)17-9-18)21-16(5,6)20-12/h9-14H,1-8H3,(H,17,18)/t10-,11-,12-,13-,14+/m1/s1 |
| InChIKey | NCHXNWVNFWOHGL-KSTCHIGDSA-N |
| XLogP | 2.39 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|