C16H29NO6Si — CID 11728082
(3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one (PubChem CID 11728082) has the molecular formula C16H29NO6Si and a molecular weight of 359.50 g/mol. Its IUPAC name is (3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one.
| Compound Name | (3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one |
|---|---|
| PubChem CID | 11728082 |
| Molecular Formula | C16H29NO6Si |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (3'aR,5S,7'S,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](CO[C@]3(CNC(=O)O3)[C@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C16H29NO6Si/c1-14(2,3)24(6,7)23-12-11-10(20-15(4,5)21-11)8-19-16(12)9-17-13(18)22-16/h10-12H,8-9H2,1-7H3,(H,17,18)/t10-,11-,12+,16+/m1/s1 |
| InChIKey | WCLWPTCBQFUICK-YMEQNVIZSA-N |
| XLogP | 2.36 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|