C23H41NO8Si — CID 58766091
tert-butyl (3'aR,5S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-diethyl-2-oxospiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-3-carboxylate (PubChem CID 58766091) has the molecular formula C23H41NO8Si and a molecular weight of 487.67 g/mol. Its IUPAC name is tert-butyl (3'aR,5S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-diethyl-2-oxospiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-3-carboxylate.
| Compound Name | tert-butyl (3'aR,5S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-diethyl-2-oxospiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-3-carboxylate |
|---|---|
| PubChem CID | 58766091 |
| Molecular Formula | C23H41NO8Si |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | tert-butyl (3'aR,5S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-diethyl-2-oxospiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-3-carboxylate |
| SMILES | CCC1(CC)OC2[C@@H](CO[C@]3(CN(C(=O)OC(C)(C)C)C(=O)O3)[C@H]2O[Si](C)(C)C(C)(C)C)O1 |
| InChI | InChI=1S/C23H41NO8Si/c1-11-22(12-2)28-15-13-27-23(14-24(19(26)31-23)18(25)30-20(3,4)5)17(16(15)29-22)32-33(9,10)21(6,7)8/h15-17H,11-14H2,1-10H3/t15-,16?,17+,23+/m1/s1 |
| InChIKey | LCABTOHHFDGBIN-DEPBDQKVSA-N |
| XLogP | 4.79 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|