C22H39NO8Si — CID 58766087
tert-butyl 2-[(3'aR,4S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-2'-oxospiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole]-3'-yl]acetate (PubChem CID 58766087) has the molecular formula C22H39NO8Si and a molecular weight of 473.64 g/mol. Its IUPAC name is tert-butyl 2-[(3'aR,4S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-2'-oxospiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole]-3'-yl]acetate.
| Compound Name | tert-butyl 2-[(3'aR,4S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-2'-oxospiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole]-3'-yl]acetate |
|---|---|
| PubChem CID | 58766087 |
| Molecular Formula | C22H39NO8Si |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.24 |
| IUPAC Name | tert-butyl 2-[(3'aR,4S,7'S)-7'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-2'-oxospiro[1,3-dioxolane-4,6'-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazole]-3'-yl]acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)OC2[C@H]1CO[C@]1(COC(C)(C)O1)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H39NO8Si/c1-19(2,3)29-15(24)11-23-14-12-26-22(13-27-21(7,8)31-22)17(16(14)28-18(23)25)30-32(9,10)20(4,5)6/h14,16-17H,11-13H2,1-10H3/t14-,16?,17+,22+/m1/s1 |
| InChIKey | OAENYUJBLLTUPP-YTKAPVGKSA-N |
| XLogP | 3.42 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|