C18H31NO7Si — CID 11014895
(3'aR,5S,7'S,7'aR)-3-acetyl-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one (PubChem CID 11014895) has the molecular formula C18H31NO7Si and a molecular weight of 401.53 g/mol. Its IUPAC name is (3'aR,5S,7'S,7'aR)-3-acetyl-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one.
| Compound Name | (3'aR,5S,7'S,7'aR)-3-acetyl-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one |
|---|---|
| PubChem CID | 11014895 |
| Molecular Formula | C18H31NO7Si |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | (3'aR,5S,7'S,7'aR)-3-acetyl-7'-[tert-butyl(dimethyl)silyl]oxy-2',2'-dimethylspiro[1,3-oxazolidine-5,6'-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran]-2-one |
| SMILES | CC(=O)N1C[C@]2(OC[C@H]3OC(C)(C)O[C@H]3[C@@H]2O[Si](C)(C)C(C)(C)C)OC1=O |
| InChI | InChI=1S/C18H31NO7Si/c1-11(20)19-10-18(25-15(19)21)14(26-27(7,8)16(2,3)4)13-12(9-22-18)23-17(5,6)24-13/h12-14H,9-10H2,1-8H3/t12-,13-,14+,18+/m1/s1 |
| InChIKey | JFNXFVJMIDOVJA-ZXTQRBJTSA-N |
| XLogP | 2.62 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|