C26H47NO9Si — CID 71819464
tert-butyl (3aS,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-(2,2-dimethylpropanoyloxymethyl)-7-formyloxy-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyridine-4-carboxylate (PubChem CID 71819464) has the molecular formula C26H47NO9Si and a molecular weight of 545.75 g/mol. Its IUPAC name is tert-butyl (3aS,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-(2,2-dimethylpropanoyloxymethyl)-7-formyloxy-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyridine-4-carboxylate.
| Compound Name | tert-butyl (3aS,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-(2,2-dimethylpropanoyloxymethyl)-7-formyloxy-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 71819464 |
| Molecular Formula | C26H47NO9Si |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.30 |
| IUPAC Name | tert-butyl (3aS,6R,7S,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-3a-(2,2-dimethylpropanoyloxymethyl)-7-formyloxy-2,2-dimethyl-5,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-b]pyridine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](OC=O)[C@@H]2OC(C)(C)O[C@@]21COC(=O)C(C)(C)C |
| InChI | InChI=1S/C26H47NO9Si/c1-22(2,3)20(29)31-15-26-19(33-25(10,11)36-26)18(32-16-28)17(35-37(12,13)24(7,8)9)14-27(26)21(30)34-23(4,5)6/h16-19H,14-15H2,1-13H3/t17-,18-,19+,26+/m1/s1 |
| InChIKey | WFBXKLPNBHHKJO-ZERGSVPKSA-N |
| XLogP | 4.61 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|